About 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid
4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid (PubChem CID 167476551) has the molecular formula C26H24F3NO5S
and a molecular weight of 519.54 g/mol. Its IUPAC name is 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid.
Molecular Properties
| Compound Name | 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid |
| PubChem CID | 167476551 |
| Molecular Formula | C26H24F3NO5S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NS(=O)(=O)c1cccc(-c2ccc(C3CCC(F)(F)CC3)cc2)c1F |
| InChI | InChI=1S/C26H24F3NO5S/c1-35-22-15-19(25(31)32)9-10-21(22)30-36(33,34)23-4-2-3-20(24(23)27)18-7-5-16(6-8-18)17-11-13-26(28,29)14-12-17/h2-10,15,17,30H,11-14H2,1H3,(H,31,32) |
| InChIKey | QGEAEPGWQNOULQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid?
The IUPAC name of 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid (CID 167476551) is 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid.
What is the SMILES notation for 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid?
The canonical SMILES for 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid is COc1cc(C(=O)O)ccc1NS(=O)(=O)c1cccc(-c2ccc(C3CCC(F)(F)CC3)cc2)c1F.
What is the InChIKey of 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid?
The InChIKey is QGEAEPGWQNOULQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24F3NO5S/c1-35-22-15-19(25(31)32)9-10-21(22)30-36(33,34)23-4-2-3-20(24(23)27)18-7-5-16(6-8-18)17-11-13-26(28,29)14-12-17/h2-10,15,17,30H,11-14H2,1H3,(H,31,32).
What are the key properties of 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid?
4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid has a molecular weight of 519.54 g/mol, XLogP of 6.29, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[4-(4,4-difluorocyclohexyl)phenyl]-2-fluorophenyl]sulfonylamino]-3-methoxybenzoic acid is sourced from PubChem (CID 167476551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).