C19H13N3O5S2 — CID 167476809
3-methoxy-4-[[2-[2-(4-nitrophenyl)ethynyl]-1,3-thiazol-4-yl]sulfanylamino]benzoic acid (PubChem CID 167476809) has the molecular formula C19H13N3O5S2 and a molecular weight of 427.46 g/mol. Its IUPAC name is 3-methoxy-4-[[2-[2-(4-nitrophenyl)ethynyl]-1,3-thiazol-4-yl]sulfanylamino]benzoic acid.
| Compound Name | 3-methoxy-4-[[2-[2-(4-nitrophenyl)ethynyl]-1,3-thiazol-4-yl]sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 167476809 |
| Molecular Formula | C19H13N3O5S2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 3-methoxy-4-[[2-[2-(4-nitrophenyl)ethynyl]-1,3-thiazol-4-yl]sulfanylamino]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSc1csc(C#Cc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H13N3O5S2/c1-27-16-10-13(19(23)24)5-8-15(16)21-29-18-11-28-17(20-18)9-4-12-2-6-14(7-3-12)22(25)26/h2-3,5-8,10-11,21H,1H3,(H,23,24) |
| InChIKey | HMCVYCDYKGGPER-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|