C21H18F3N2O5PS2 — CID 167475877
ethoxy-[3-methoxy-4-[[2-[2-[3-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfanylamino]phenyl]phosphinic acid (PubChem CID 167475877) has the molecular formula C21H18F3N2O5PS2 and a molecular weight of 530.49 g/mol. Its IUPAC name is ethoxy-[3-methoxy-4-[[2-[2-[3-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfanylamino]phenyl]phosphinic acid.
| Compound Name | ethoxy-[3-methoxy-4-[[2-[2-[3-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfanylamino]phenyl]phosphinic acid |
|---|---|
| PubChem CID | 167475877 |
| Molecular Formula | C21H18F3N2O5PS2 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | ethoxy-[3-methoxy-4-[[2-[2-[3-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfanylamino]phenyl]phosphinic acid |
| SMILES | CCOP(=O)(O)c1ccc(NSc2csc(C#Cc3cccc(OC(F)(F)F)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C21H18F3N2O5PS2/c1-3-30-32(27,28)16-8-9-17(18(12-16)29-2)26-34-20-13-33-19(25-20)10-7-14-5-4-6-15(11-14)31-21(22,23)24/h4-6,8-9,11-13,26H,3H2,1-2H3,(H,27,28) |
| InChIKey | YQALYFCHEXOGDS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|