C21H15F3N2O7S2 — CID 167476721
3-methoxy-4-[[2-[2-[2-methoxy-5-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfonylamino]benzoic acid (PubChem CID 167476721) has the molecular formula C21H15F3N2O7S2 and a molecular weight of 528.49 g/mol. Its IUPAC name is 3-methoxy-4-[[2-[2-[2-methoxy-5-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfonylamino]benzoic acid.
| Compound Name | 3-methoxy-4-[[2-[2-[2-methoxy-5-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 167476721 |
| Molecular Formula | C21H15F3N2O7S2 |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.03 |
| IUPAC Name | 3-methoxy-4-[[2-[2-[2-methoxy-5-(trifluoromethoxy)phenyl]ethynyl]-1,3-thiazol-4-yl]sulfonylamino]benzoic acid |
| SMILES | COc1ccc(OC(F)(F)F)cc1C#Cc1nc(S(=O)(=O)Nc2ccc(C(=O)O)cc2OC)cs1 |
| InChI | InChI=1S/C21H15F3N2O7S2/c1-31-16-7-5-14(33-21(22,23)24)9-12(16)4-8-18-25-19(11-34-18)35(29,30)26-15-6-3-13(20(27)28)10-17(15)32-2/h3,5-7,9-11,26H,1-2H3,(H,27,28) |
| InChIKey | BYYQGYJFOGOGAP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|