C20H15FN2O5S2 — CID 168726537
2-fluoro-5-methoxy-4-[[2-[2-(4-methylphenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]benzoic acid (PubChem CID 168726537) has the molecular formula C20H15FN2O5S2 and a molecular weight of 446.48 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-4-[[2-[2-(4-methylphenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]benzoic acid.
| Compound Name | 2-fluoro-5-methoxy-4-[[2-[2-(4-methylphenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 168726537 |
| Molecular Formula | C20H15FN2O5S2 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-fluoro-5-methoxy-4-[[2-[2-(4-methylphenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]benzoic acid |
| SMILES | COc1cc(C(=O)O)c(F)cc1NS(=O)(=O)c1csc(C#Cc2ccc(C)cc2)n1 |
| InChI | InChI=1S/C20H15FN2O5S2/c1-12-3-5-13(6-4-12)7-8-18-22-19(11-29-18)30(26,27)23-16-10-15(21)14(20(24)25)9-17(16)28-2/h3-6,9-11,23H,1-2H3,(H,24,25) |
| InChIKey | RIIQGFGVANBACN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|