C34H18F14N2O5S2 — CID 167475636
2-fluoro-4-[[2-[4-[4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-(trifluoromethyl)phenyl]-2-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]sulfonylamino]-5-methoxybenzoic acid (PubChem CID 167475636) has the molecular formula C34H18F14N2O5S2 and a molecular weight of 864.63 g/mol. Its IUPAC name is 2-fluoro-4-[[2-[4-[4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-(trifluoromethyl)phenyl]-2-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]sulfonylamino]-5-methoxybenzoic acid.
| Compound Name | 2-fluoro-4-[[2-[4-[4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-(trifluoromethyl)phenyl]-2-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]sulfonylamino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 167475636 |
| Molecular Formula | C34H18F14N2O5S2 |
| Molecular Weight | 864.63 g/mol |
| Exact Mass | 864.04 |
| IUPAC Name | 2-fluoro-4-[[2-[4-[4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-(trifluoromethyl)phenyl]-2-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]sulfonylamino]-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(F)cc1NS(=O)(=O)c1csc(-c2ccc(-c3ccc(-c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4)cc3C(F)(F)F)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C34H18F14N2O5S2/c1-55-26-12-21(29(51)52)24(35)13-25(26)50-57(53,54)27-14-56-28(49-27)20-9-5-17(11-23(20)32(40,41)42)19-8-4-16(10-22(19)31(37,38)39)15-2-6-18(7-3-15)30(36,33(43,44)45)34(46,47)48/h2-14,50H,1H3,(H,51,52) |
| InChIKey | GCIZVMVWQPUYLX-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.63 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |