C26H15F9N2O4S2 — CID 167476754
2-fluoro-4-[[2-[2-fluoro-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-hydroxyphenyl]-1,3-thiazol-4-yl]sulfanylamino]-5-methoxybenzoic acid (PubChem CID 167476754) has the molecular formula C26H15F9N2O4S2 and a molecular weight of 654.53 g/mol. Its IUPAC name is 2-fluoro-4-[[2-[2-fluoro-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-hydroxyphenyl]-1,3-thiazol-4-yl]sulfanylamino]-5-methoxybenzoic acid.
| Compound Name | 2-fluoro-4-[[2-[2-fluoro-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-hydroxyphenyl]-1,3-thiazol-4-yl]sulfanylamino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476754 |
| Molecular Formula | C26H15F9N2O4S2 |
| Molecular Weight | 654.53 g/mol |
| Exact Mass | 654.03 |
| IUPAC Name | 2-fluoro-4-[[2-[2-fluoro-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-hydroxyphenyl]-1,3-thiazol-4-yl]sulfanylamino]-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(F)cc1NSc1csc(-c2ccc(-c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)c(O)c2F)n1 |
| InChI | InChI=1S/C26H15F9N2O4S2/c1-41-18-8-15(23(39)40)16(27)9-17(18)37-43-19-10-42-22(36-19)14-7-6-13(21(38)20(14)28)11-2-4-12(5-3-11)24(29,25(30,31)32)26(33,34)35/h2-10,37-38H,1H3,(H,39,40) |
| InChIKey | WXDUBQXKRGWTFC-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.53 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|