C18H13N3O3S2 — CID 167475705
4-[[2-(2-cyanophenyl)-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid (PubChem CID 167475705) has the molecular formula C18H13N3O3S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-[[2-(2-cyanophenyl)-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[2-(2-cyanophenyl)-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 167475705 |
| Molecular Formula | C18H13N3O3S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 4-[[2-(2-cyanophenyl)-1,3-thiazol-4-yl]sulfanylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSc1csc(-c2ccccc2C#N)n1 |
| InChI | InChI=1S/C18H13N3O3S2/c1-24-15-8-11(18(22)23)6-7-14(15)21-26-16-10-25-17(20-16)13-5-3-2-4-12(13)9-19/h2-8,10,21H,1H3,(H,22,23) |
| InChIKey | VAKAUQOIQFSHTH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|