C22H18N2O3S2 — CID 167475917
3-methoxy-4-[[2-(2-methylnaphthalen-1-yl)-1,3-thiazol-4-yl]sulfanylamino]benzoic acid (PubChem CID 167475917) has the molecular formula C22H18N2O3S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-methoxy-4-[[2-(2-methylnaphthalen-1-yl)-1,3-thiazol-4-yl]sulfanylamino]benzoic acid.
| Compound Name | 3-methoxy-4-[[2-(2-methylnaphthalen-1-yl)-1,3-thiazol-4-yl]sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 167475917 |
| Molecular Formula | C22H18N2O3S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 3-methoxy-4-[[2-(2-methylnaphthalen-1-yl)-1,3-thiazol-4-yl]sulfanylamino]benzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NSc1csc(-c2c(C)ccc3ccccc23)n1 |
| InChI | InChI=1S/C22H18N2O3S2/c1-13-7-8-14-5-3-4-6-16(14)20(13)21-23-19(12-28-21)29-24-17-10-9-15(22(25)26)11-18(17)27-2/h3-12,24H,1-2H3,(H,25,26) |
| InChIKey | GDJGAPWWUHXGQG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|