C32H30FIN2O6S2 — CID 167476772
2-fluoro-4-[[2-[4-[4-(3-iodo-3-bicyclo[3.2.1]octanyl)phenyl]-2-methoxyphenyl]-1,3-thiazol-4-yl]sulfonylamino]-5-methoxybenzoic acid (PubChem CID 167476772) has the molecular formula C32H30FIN2O6S2 and a molecular weight of 748.64 g/mol. Its IUPAC name is 2-fluoro-4-[[2-[4-[4-(3-iodo-3-bicyclo[3.2.1]octanyl)phenyl]-2-methoxyphenyl]-1,3-thiazol-4-yl]sulfonylamino]-5-methoxybenzoic acid.
| Compound Name | 2-fluoro-4-[[2-[4-[4-(3-iodo-3-bicyclo[3.2.1]octanyl)phenyl]-2-methoxyphenyl]-1,3-thiazol-4-yl]sulfonylamino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 167476772 |
| Molecular Formula | C32H30FIN2O6S2 |
| Molecular Weight | 748.64 g/mol |
| Exact Mass | 748.06 |
| IUPAC Name | 2-fluoro-4-[[2-[4-[4-(3-iodo-3-bicyclo[3.2.1]octanyl)phenyl]-2-methoxyphenyl]-1,3-thiazol-4-yl]sulfonylamino]-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(F)cc1NS(=O)(=O)c1csc(-c2ccc(-c3ccc(C4(I)CC5CCC(C5)C4)cc3)cc2OC)n1 |
| InChI | InChI=1S/C32H30FIN2O6S2/c1-41-27-12-21(20-5-8-22(9-6-20)32(34)15-18-3-4-19(11-18)16-32)7-10-23(27)30-35-29(17-43-30)44(39,40)36-26-14-25(33)24(31(37)38)13-28(26)42-2/h5-10,12-14,17-19,36H,3-4,11,15-16H2,1-2H3,(H,37,38) |
| InChIKey | MXHCIJPBCQKLBY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.64 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|