C20H15N3O6S2 — CID 168726267
4-[[2-[2-(4-formamidophenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid (PubChem CID 168726267) has the molecular formula C20H15N3O6S2 and a molecular weight of 457.49 g/mol. Its IUPAC name is 4-[[2-[2-(4-formamidophenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid.
| Compound Name | 4-[[2-[2-(4-formamidophenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 168726267 |
| Molecular Formula | C20H15N3O6S2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 4-[[2-[2-(4-formamidophenyl)ethynyl]-1,3-thiazol-4-yl]sulfonylamino]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1NS(=O)(=O)c1csc(C#Cc2ccc(NC=O)cc2)n1 |
| InChI | InChI=1S/C20H15N3O6S2/c1-29-17-10-14(20(25)26)5-8-16(17)23-31(27,28)19-11-30-18(22-19)9-4-13-2-6-15(7-3-13)21-12-24/h2-3,5-8,10-12,23H,1H3,(H,21,24)(H,25,26) |
| InChIKey | UBVXYNSUTFUNIK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|