C26H18O6 — CID 102265510
4-[2-[2-[2-(4-carboxyphenyl)ethynyl]-4,5-dimethoxyphenyl]ethynyl]benzoic acid (PubChem CID 102265510) has the molecular formula C26H18O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is 4-[2-[2-[2-(4-carboxyphenyl)ethynyl]-4,5-dimethoxyphenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[2-[2-(4-carboxyphenyl)ethynyl]-4,5-dimethoxyphenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 102265510 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-[2-[2-[2-(4-carboxyphenyl)ethynyl]-4,5-dimethoxyphenyl]ethynyl]benzoic acid |
| SMILES | COc1cc(C#Cc2ccc(C(=O)O)cc2)c(C#Cc2ccc(C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C26H18O6/c1-31-23-15-21(13-7-17-3-9-19(10-4-17)25(27)28)22(16-24(23)32-2)14-8-18-5-11-20(12-6-18)26(29)30/h3-6,9-12,15-16H,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | KUTIEZRWGHRGOL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|