C27H22O5 — CID 170459702
methyl 4-[2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethynyl]-2-methoxybenzoate (PubChem CID 170459702) has the molecular formula C27H22O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is methyl 4-[2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethynyl]-2-methoxybenzoate.
| Compound Name | methyl 4-[2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethynyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 170459702 |
| Molecular Formula | C27H22O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | methyl 4-[2-[4,5-dimethoxy-2-(2-phenylethynyl)phenyl]ethynyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1ccc(C#Cc2cc(OC)c(OC)cc2C#Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C27H22O5/c1-29-24-16-20(12-15-23(24)27(28)32-4)11-14-22-18-26(31-3)25(30-2)17-21(22)13-10-19-8-6-5-7-9-19/h5-9,12,15-18H,1-4H3 |
| InChIKey | PIVDPHDQJGPDOP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|