C21H17BrO3 — CID 170457247
methyl 4-[2-[3-(4-bromobut-1-ynyl)phenyl]ethynyl]-2-methoxybenzoate (PubChem CID 170457247) has the molecular formula C21H17BrO3 and a molecular weight of 397.27 g/mol. Its IUPAC name is methyl 4-[2-[3-(4-bromobut-1-ynyl)phenyl]ethynyl]-2-methoxybenzoate.
| Compound Name | methyl 4-[2-[3-(4-bromobut-1-ynyl)phenyl]ethynyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 170457247 |
| Molecular Formula | C21H17BrO3 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | methyl 4-[2-[3-(4-bromobut-1-ynyl)phenyl]ethynyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1ccc(C#Cc2cccc(C#CCCBr)c2)cc1OC |
| InChI | InChI=1S/C21H17BrO3/c1-24-20-15-18(11-12-19(20)21(23)25-2)10-9-17-8-5-7-16(14-17)6-3-4-13-22/h5,7-8,11-12,14-15H,4,13H2,1-2H3 |
| InChIKey | CWSQSISLPGJHCY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|