C22H19BrO4 — CID 170457256
methyl 4-[2-[2-(4-bromobut-1-ynyl)-4,5-dimethoxyphenyl]ethynyl]benzoate (PubChem CID 170457256) has the molecular formula C22H19BrO4 and a molecular weight of 427.29 g/mol. Its IUPAC name is methyl 4-[2-[2-(4-bromobut-1-ynyl)-4,5-dimethoxyphenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[2-(4-bromobut-1-ynyl)-4,5-dimethoxyphenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 170457256 |
| Molecular Formula | C22H19BrO4 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | methyl 4-[2-[2-(4-bromobut-1-ynyl)-4,5-dimethoxyphenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2cc(OC)c(OC)cc2C#CCCBr)cc1 |
| InChI | InChI=1S/C22H19BrO4/c1-25-20-14-18(6-4-5-13-23)19(15-21(20)26-2)12-9-16-7-10-17(11-8-16)22(24)27-3/h7-8,10-11,14-15H,5,13H2,1-3H3 |
| InChIKey | YCGGKHZLUADAAX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|