C19H13BrO2 — CID 170457195
methyl 4-[2-[2-(3-bromoprop-1-ynyl)phenyl]ethynyl]benzoate (PubChem CID 170457195) has the molecular formula C19H13BrO2 and a molecular weight of 353.22 g/mol. Its IUPAC name is methyl 4-[2-[2-(3-bromoprop-1-ynyl)phenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[2-(3-bromoprop-1-ynyl)phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 170457195 |
| Molecular Formula | C19H13BrO2 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | methyl 4-[2-[2-(3-bromoprop-1-ynyl)phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccccc2C#CCBr)cc1 |
| InChI | InChI=1S/C19H13BrO2/c1-22-19(21)18-12-9-15(10-13-18)8-11-17-6-3-2-5-16(17)7-4-14-20/h2-3,5-6,9-10,12-13H,14H2,1H3 |
| InChIKey | HBALSIJRBQIYAR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|