C27H17Cl3F2O4 — CID 139125287
chloroform;methyl 4-[2-[2,3-difluoro-4-[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate (PubChem CID 139125287) has the molecular formula C27H17Cl3F2O4 and a molecular weight of 549.78 g/mol. Its IUPAC name is chloroform;methyl 4-[2-[2,3-difluoro-4-[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate.
| Compound Name | chloroform;methyl 4-[2-[2,3-difluoro-4-[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 139125287 |
| Molecular Formula | C27H17Cl3F2O4 |
| Molecular Weight | 549.78 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | chloroform;methyl 4-[2-[2,3-difluoro-4-[2-(4-methoxycarbonylphenyl)ethynyl]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccc(C#Cc3ccc(C(=O)OC)cc3)c(F)c2F)cc1.ClC(Cl)Cl |
| InChI | InChI=1S/C26H16F2O4.CHCl3/c1-31-25(29)21-11-5-17(6-12-21)3-9-19-15-16-20(24(28)23(19)27)10-4-18-7-13-22(14-8-18)26(30)32-2;2-1(3)4/h5-8,11-16H,1-2H3;1H |
| InChIKey | DNIQZDUAJQHMCC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.78 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|