C17H13NO3 — CID 44521601
methyl 4-[2-(2-formamidophenyl)ethynyl]benzoate (PubChem CID 44521601) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is methyl 4-[2-(2-formamidophenyl)ethynyl]benzoate.
| Compound Name | methyl 4-[2-(2-formamidophenyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 44521601 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | methyl 4-[2-(2-formamidophenyl)ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccccc2NC=O)cc1 |
| InChI | InChI=1S/C17H13NO3/c1-21-17(20)15-10-7-13(8-11-15)6-9-14-4-2-3-5-16(14)18-12-19/h2-5,7-8,10-12H,1H3,(H,18,19) |
| InChIKey | MDRIQGHODRQDLP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|