C23H19NO4S — CID 150173171
methyl 4-[2-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethynyl]benzoate (PubChem CID 150173171) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is methyl 4-[2-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 150173171 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | methyl 4-[2-[2-[(4-methylphenyl)sulfonylamino]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccccc2NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H19NO4S/c1-17-7-15-21(16-8-17)29(26,27)24-22-6-4-3-5-19(22)12-9-18-10-13-20(14-11-18)23(25)28-2/h3-8,10-11,13-16,24H,1-2H3 |
| InChIKey | FJVYLTCRAHTZNW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|