C26H19NO4S — CID 150025753
4-[2-[2-[(4-methylnaphthalen-1-yl)sulfonylamino]phenyl]ethynyl]benzoic acid (PubChem CID 150025753) has the molecular formula C26H19NO4S and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-[2-[2-[(4-methylnaphthalen-1-yl)sulfonylamino]phenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[2-[(4-methylnaphthalen-1-yl)sulfonylamino]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 150025753 |
| Molecular Formula | C26H19NO4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 4-[2-[2-[(4-methylnaphthalen-1-yl)sulfonylamino]phenyl]ethynyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2C#Cc2ccc(C(=O)O)cc2)c2ccccc12 |
| InChI | InChI=1S/C26H19NO4S/c1-18-10-17-25(23-8-4-3-7-22(18)23)32(30,31)27-24-9-5-2-6-20(24)14-11-19-12-15-21(16-13-19)26(28)29/h2-10,12-13,15-17,27H,1H3,(H,28,29) |
| InChIKey | DGEXDDPELFPCJG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|