C27H22N2O6S — CID 147517280
2-methoxy-4-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-5-methylbenzoic acid (PubChem CID 147517280) has the molecular formula C27H22N2O6S and a molecular weight of 502.55 g/mol. Its IUPAC name is 2-methoxy-4-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-5-methylbenzoic acid.
| Compound Name | 2-methoxy-4-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 147517280 |
| Molecular Formula | C27H22N2O6S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 2-methoxy-4-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-5-methylbenzoic acid |
| SMILES | COc1cc(C#Cc2ccccc2NS(=O)(=O)c2ccc(OC)c3cccnc23)c(C)cc1C(=O)O |
| InChI | InChI=1S/C27H22N2O6S/c1-17-15-21(27(30)31)24(35-3)16-19(17)11-10-18-7-4-5-9-22(18)29-36(32,33)25-13-12-23(34-2)20-8-6-14-28-26(20)25/h4-9,12-16,29H,1-3H3,(H,30,31) |
| InChIKey | FKLWSFOEWQMXSC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|