C24H17N3O5S — CID 150303390
5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]pyridine-2-carboxylic acid (PubChem CID 150303390) has the molecular formula C24H17N3O5S and a molecular weight of 459.48 g/mol. Its IUPAC name is 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 150303390 |
| Molecular Formula | C24H17N3O5S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]pyridine-2-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2C#Cc2ccc(C(=O)O)nc2)c2ncccc12 |
| InChI | InChI=1S/C24H17N3O5S/c1-32-21-12-13-22(23-18(21)6-4-14-25-23)33(30,31)27-19-7-3-2-5-17(19)10-8-16-9-11-20(24(28)29)26-15-16/h2-7,9,11-15,27H,1H3,(H,28,29) |
| InChIKey | GKBULVNTEXLKJY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|