C25H21N3O3S — CID 175843288
4-propan-2-yloxy-N-[2-(2-pyridin-3-ylethynyl)phenyl]quinoline-8-sulfonamide (PubChem CID 175843288) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-propan-2-yloxy-N-[2-(2-pyridin-3-ylethynyl)phenyl]quinoline-8-sulfonamide.
| Compound Name | 4-propan-2-yloxy-N-[2-(2-pyridin-3-ylethynyl)phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 175843288 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-propan-2-yloxy-N-[2-(2-pyridin-3-ylethynyl)phenyl]quinoline-8-sulfonamide |
| SMILES | CC(C)Oc1ccnc2c(S(=O)(=O)Nc3ccccc3C#Cc3cccnc3)cccc12 |
| InChI | InChI=1S/C25H21N3O3S/c1-18(2)31-23-14-16-27-25-21(23)9-5-11-24(25)32(29,30)28-22-10-4-3-8-20(22)13-12-19-7-6-15-26-17-19/h3-11,14-18,28H,1-2H3 |
| InChIKey | YGFLSZGQXNKGBW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|