C30H21N3O5S — CID 151344376
5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]-5-phenylphenyl]ethynyl]pyridine-2-carboxylic acid (PubChem CID 151344376) has the molecular formula C30H21N3O5S and a molecular weight of 535.58 g/mol. Its IUPAC name is 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]-5-phenylphenyl]ethynyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]-5-phenylphenyl]ethynyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 151344376 |
| Molecular Formula | C30H21N3O5S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]-5-phenylphenyl]ethynyl]pyridine-2-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(-c3ccccc3)cc2C#Cc2ccc(C(=O)O)nc2)c2ncccc12 |
| InChI | InChI=1S/C30H21N3O5S/c1-38-27-15-16-28(29-24(27)8-5-17-31-29)39(36,37)33-25-14-12-22(21-6-3-2-4-7-21)18-23(25)11-9-20-10-13-26(30(34)35)32-19-20/h2-8,10,12-19,33H,1H3,(H,34,35) |
| InChIKey | OLDLVDHKRLRFLH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|