C31H23N3O5S — CID 151351772
benzyl 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]pyridine-2-carboxylate (PubChem CID 151351772) has the molecular formula C31H23N3O5S and a molecular weight of 549.61 g/mol. Its IUPAC name is benzyl 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]pyridine-2-carboxylate.
| Compound Name | benzyl 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 151351772 |
| Molecular Formula | C31H23N3O5S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.14 |
| IUPAC Name | benzyl 5-[2-[2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]pyridine-2-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2C#Cc2ccc(C(=O)OCc3ccccc3)nc2)c2ncccc12 |
| InChI | InChI=1S/C31H23N3O5S/c1-38-28-17-18-29(30-25(28)11-7-19-32-30)40(36,37)34-26-12-6-5-10-24(26)15-13-22-14-16-27(33-20-22)31(35)39-21-23-8-3-2-4-9-23/h2-12,14,16-20,34H,21H2,1H3 |
| InChIKey | OMQCZTXKBGFJRW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|