C25H18FN3O5S — CID 151872225
5-[2-[5-fluoro-2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-3-methylpyridine-2-carboxylic acid (PubChem CID 151872225) has the molecular formula C25H18FN3O5S and a molecular weight of 491.50 g/mol. Its IUPAC name is 5-[2-[5-fluoro-2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-3-methylpyridine-2-carboxylic acid.
| Compound Name | 5-[2-[5-fluoro-2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-3-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 151872225 |
| Molecular Formula | C25H18FN3O5S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 5-[2-[5-fluoro-2-[(5-methoxyquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-3-methylpyridine-2-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(F)cc2C#Cc2cnc(C(=O)O)c(C)c2)c2ncccc12 |
| InChI | InChI=1S/C25H18FN3O5S/c1-15-12-16(14-28-23(15)25(30)31)5-6-17-13-18(26)7-8-20(17)29-35(32,33)22-10-9-21(34-2)19-4-3-11-27-24(19)22/h3-4,7-14,29H,1-2H3,(H,30,31) |
| InChIKey | SMXXKGXBPHBALP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|