C16H10F2N2O4S — CID 55676538
5-fluoro-2-[(8-fluoroquinolin-5-yl)sulfonylamino]benzoic acid (PubChem CID 55676538) has the molecular formula C16H10F2N2O4S and a molecular weight of 364.33 g/mol. Its IUPAC name is 5-fluoro-2-[(8-fluoroquinolin-5-yl)sulfonylamino]benzoic acid.
| Compound Name | 5-fluoro-2-[(8-fluoroquinolin-5-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 55676538 |
| Molecular Formula | C16H10F2N2O4S |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 5-fluoro-2-[(8-fluoroquinolin-5-yl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1NS(=O)(=O)c1ccc(F)c2ncccc12 |
| InChI | InChI=1S/C16H10F2N2O4S/c17-9-3-5-13(11(8-9)16(21)22)20-25(23,24)14-6-4-12(18)15-10(14)2-1-7-19-15/h1-8,20H,(H,21,22) |
| InChIKey | ACDLNLLFYUVYGS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |