C13H11FN4O2S — CID 31914993
8-fluoro-N-(1-methylpyrazol-3-yl)quinoline-5-sulfonamide (PubChem CID 31914993) has the molecular formula C13H11FN4O2S and a molecular weight of 306.32 g/mol. Its IUPAC name is 8-fluoro-N-(1-methylpyrazol-3-yl)quinoline-5-sulfonamide.
| Compound Name | 8-fluoro-N-(1-methylpyrazol-3-yl)quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 31914993 |
| Molecular Formula | C13H11FN4O2S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 8-fluoro-N-(1-methylpyrazol-3-yl)quinoline-5-sulfonamide |
| SMILES | Cn1ccc(NS(=O)(=O)c2ccc(F)c3ncccc23)n1 |
| InChI | InChI=1S/C13H11FN4O2S/c1-18-8-6-12(16-18)17-21(19,20)11-5-4-10(14)13-9(11)3-2-7-15-13/h2-8H,1H3,(H,16,17) |
| InChIKey | BHXVNCVSYUFPRE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |