C16H11FN2O4S — CID 39824436
3-[(8-fluoroquinolin-5-yl)sulfonylamino]benzoic acid (PubChem CID 39824436) has the molecular formula C16H11FN2O4S and a molecular weight of 346.34 g/mol. Its IUPAC name is 3-[(8-fluoroquinolin-5-yl)sulfonylamino]benzoic acid.
| Compound Name | 3-[(8-fluoroquinolin-5-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 39824436 |
| Molecular Formula | C16H11FN2O4S |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-[(8-fluoroquinolin-5-yl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2ccc(F)c3ncccc23)c1 |
| InChI | InChI=1S/C16H11FN2O4S/c17-13-6-7-14(12-5-2-8-18-15(12)13)24(22,23)19-11-4-1-3-10(9-11)16(20)21/h1-9,19H,(H,20,21) |
| InChIKey | ISFXAZJAPYRFMC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |