C24H19N3O3S — CID 175843075
5-methoxy-N-[2-[2-(4-methyl-3-pyridinyl)ethynyl]phenyl]quinoline-8-sulfonamide (PubChem CID 175843075) has the molecular formula C24H19N3O3S and a molecular weight of 429.50 g/mol. Its IUPAC name is 5-methoxy-N-[2-[2-(4-methyl-3-pyridinyl)ethynyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | 5-methoxy-N-[2-[2-(4-methyl-3-pyridinyl)ethynyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 175843075 |
| Molecular Formula | C24H19N3O3S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 5-methoxy-N-[2-[2-(4-methyl-3-pyridinyl)ethynyl]phenyl]quinoline-8-sulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2C#Cc2cnccc2C)c2ncccc12 |
| InChI | InChI=1S/C24H19N3O3S/c1-17-13-15-25-16-19(17)10-9-18-6-3-4-8-21(18)27-31(28,29)23-12-11-22(30-2)20-7-5-14-26-24(20)23/h3-8,11-16,27H,1-2H3 |
| InChIKey | NHWZOXOVYMGJJH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|