C24H17BrFN3O4S — CID 175843163
N-[4-bromo-5-fluoro-2-[2-(4-methoxy-3-pyridinyl)ethynyl]phenyl]-5-methoxyquinoline-8-sulfonamide (PubChem CID 175843163) has the molecular formula C24H17BrFN3O4S and a molecular weight of 542.39 g/mol. Its IUPAC name is N-[4-bromo-5-fluoro-2-[2-(4-methoxy-3-pyridinyl)ethynyl]phenyl]-5-methoxyquinoline-8-sulfonamide.
| Compound Name | N-[4-bromo-5-fluoro-2-[2-(4-methoxy-3-pyridinyl)ethynyl]phenyl]-5-methoxyquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 175843163 |
| Molecular Formula | C24H17BrFN3O4S |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | N-[4-bromo-5-fluoro-2-[2-(4-methoxy-3-pyridinyl)ethynyl]phenyl]-5-methoxyquinoline-8-sulfonamide |
| SMILES | COc1ccncc1C#Cc1cc(Br)c(F)cc1NS(=O)(=O)c1ccc(OC)c2cccnc12 |
| InChI | InChI=1S/C24H17BrFN3O4S/c1-32-21-9-11-27-14-16(21)6-5-15-12-18(25)19(26)13-20(15)29-34(30,31)23-8-7-22(33-2)17-4-3-10-28-24(17)23/h3-4,7-14,29H,1-2H3 |
| InChIKey | QOHSJQJHHMQXMY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|