C23H15BrFN3O2S — CID 175843256
N-[4-bromo-5-fluoro-2-(2-pyridin-3-ylethynyl)phenyl]-7-methylquinoline-8-sulfonamide (PubChem CID 175843256) has the molecular formula C23H15BrFN3O2S and a molecular weight of 496.36 g/mol. Its IUPAC name is N-[4-bromo-5-fluoro-2-(2-pyridin-3-ylethynyl)phenyl]-7-methylquinoline-8-sulfonamide.
| Compound Name | N-[4-bromo-5-fluoro-2-(2-pyridin-3-ylethynyl)phenyl]-7-methylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 175843256 |
| Molecular Formula | C23H15BrFN3O2S |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | N-[4-bromo-5-fluoro-2-(2-pyridin-3-ylethynyl)phenyl]-7-methylquinoline-8-sulfonamide |
| SMILES | Cc1ccc2cccnc2c1S(=O)(=O)Nc1cc(F)c(Br)cc1C#Cc1cccnc1 |
| InChI | InChI=1S/C23H15BrFN3O2S/c1-15-6-8-17-5-3-11-27-22(17)23(15)31(29,30)28-21-13-20(25)19(24)12-18(21)9-7-16-4-2-10-26-14-16/h2-6,8,10-14,28H,1H3 |
| InChIKey | STQLXWRUKDZNQH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|