C27H21N3O4S — CID 152516697
5-[2-[2-[(7-methylquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-4-prop-1-en-2-ylpyridine-2-carboxylic acid (PubChem CID 152516697) has the molecular formula C27H21N3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is 5-[2-[2-[(7-methylquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-4-prop-1-en-2-ylpyridine-2-carboxylic acid.
| Compound Name | 5-[2-[2-[(7-methylquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-4-prop-1-en-2-ylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 152516697 |
| Molecular Formula | C27H21N3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 5-[2-[2-[(7-methylquinolin-8-yl)sulfonylamino]phenyl]ethynyl]-4-prop-1-en-2-ylpyridine-2-carboxylic acid |
| SMILES | C=C(C)c1cc(C(=O)O)ncc1C#Cc1ccccc1NS(=O)(=O)c1c(C)ccc2cccnc12 |
| InChI | InChI=1S/C27H21N3O4S/c1-17(2)22-15-24(27(31)32)29-16-21(22)13-12-19-7-4-5-9-23(19)30-35(33,34)26-18(3)10-11-20-8-6-14-28-25(20)26/h4-11,14-16,30H,1H2,2-3H3,(H,31,32) |
| InChIKey | YGQWKXNNFCQTOS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|