C24H15Cl2N3O3S — CID 154949052
N-[2-[2-(6-acetyl-3-pyridinyl)ethynyl]phenyl]-2,4-dichloroquinoline-8-sulfonamide (PubChem CID 154949052) has the molecular formula C24H15Cl2N3O3S and a molecular weight of 496.38 g/mol. Its IUPAC name is N-[2-[2-(6-acetyl-3-pyridinyl)ethynyl]phenyl]-2,4-dichloroquinoline-8-sulfonamide.
| Compound Name | N-[2-[2-(6-acetyl-3-pyridinyl)ethynyl]phenyl]-2,4-dichloroquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 154949052 |
| Molecular Formula | C24H15Cl2N3O3S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.02 |
| IUPAC Name | N-[2-[2-(6-acetyl-3-pyridinyl)ethynyl]phenyl]-2,4-dichloroquinoline-8-sulfonamide |
| SMILES | CC(=O)c1ccc(C#Cc2ccccc2NS(=O)(=O)c2cccc3c(Cl)cc(Cl)nc23)cn1 |
| InChI | InChI=1S/C24H15Cl2N3O3S/c1-15(30)20-12-10-16(14-27-20)9-11-17-5-2-3-7-21(17)29-33(31,32)22-8-4-6-18-19(25)13-23(26)28-24(18)22/h2-8,10,12-14,29H,1H3 |
| InChIKey | GHDFXIARBJKDEW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|