C28H18ClN3O4S — CID 148720493
methyl 4-[2-[2-[(4-chloroquinolin-8-yl)sulfonylamino]phenyl]ethynyl]isoquinoline-1-carboxylate (PubChem CID 148720493) has the molecular formula C28H18ClN3O4S and a molecular weight of 527.99 g/mol. Its IUPAC name is methyl 4-[2-[2-[(4-chloroquinolin-8-yl)sulfonylamino]phenyl]ethynyl]isoquinoline-1-carboxylate.
| Compound Name | methyl 4-[2-[2-[(4-chloroquinolin-8-yl)sulfonylamino]phenyl]ethynyl]isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 148720493 |
| Molecular Formula | C28H18ClN3O4S |
| Molecular Weight | 527.99 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | methyl 4-[2-[2-[(4-chloroquinolin-8-yl)sulfonylamino]phenyl]ethynyl]isoquinoline-1-carboxylate |
| SMILES | COC(=O)c1ncc(C#Cc2ccccc2NS(=O)(=O)c2cccc3c(Cl)ccnc23)c2ccccc12 |
| InChI | InChI=1S/C28H18ClN3O4S/c1-36-28(33)27-21-9-4-3-8-20(21)19(17-31-27)14-13-18-7-2-5-11-24(18)32-37(34,35)25-12-6-10-22-23(29)15-16-30-26(22)25/h2-12,15-17,32H,1H3 |
| InChIKey | NYZLLMRXLBTWSN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.99 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|