C17H18N2O2 — CID 145372120
ethane;ethene;1,10-phenanthroline-2-carboxylic acid (PubChem CID 145372120) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethane;ethene;1,10-phenanthroline-2-carboxylic acid.
| Compound Name | ethane;ethene;1,10-phenanthroline-2-carboxylic acid |
|---|---|
| PubChem CID | 145372120 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | ethane;ethene;1,10-phenanthroline-2-carboxylic acid |
| SMILES | C=C.CC.O=C(O)c1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C13H8N2O2.C2H6.C2H4/c16-13(17)10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10;2*1-2/h1-7H,(H,16,17);1-2H3;1-2H2 |
| InChIKey | OFKINILCZAJHTJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|