C13H7N2O2Tb+2 — CID 161309891
1,10-phenanthroline-2-carboxylate;terbium(3+) (PubChem CID 161309891) has the molecular formula C13H7N2O2Tb+2 and a molecular weight of 382.14 g/mol. Its IUPAC name is 1,10-phenanthroline-2-carboxylate;terbium(3+).
| Compound Name | 1,10-phenanthroline-2-carboxylate;terbium(3+) |
|---|---|
| PubChem CID | 161309891 |
| Molecular Formula | C13H7N2O2Tb+2 |
| Molecular Weight | 382.14 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 1,10-phenanthroline-2-carboxylate;terbium(3+) |
| SMILES | O=C([O-])c1ccc2ccc3cccnc3c2n1.[Tb+3] |
| InChI | InChI=1S/C13H8N2O2.Tb/c16-13(17)10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10;/h1-7H,(H,16,17);/q;+3/p-1 |
| InChIKey | VISYXDNXFKMEBW-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.14 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|