C26H14N4O4Ru — CID 175903843
bis(1,10-phenanthroline-2-carboxylate);ruthenium(2+) (PubChem CID 175903843) has the molecular formula C26H14N4O4Ru and a molecular weight of 547.49 g/mol. Its IUPAC name is bis(1,10-phenanthroline-2-carboxylate);ruthenium(2+).
| Compound Name | bis(1,10-phenanthroline-2-carboxylate);ruthenium(2+) |
|---|---|
| PubChem CID | 175903843 |
| Molecular Formula | C26H14N4O4Ru |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | bis(1,10-phenanthroline-2-carboxylate);ruthenium(2+) |
| SMILES | O=C([O-])c1ccc2ccc3cccnc3c2n1.O=C([O-])c1ccc2ccc3cccnc3c2n1.[Ru+2] |
| InChI | InChI=1S/2C13H8N2O2.Ru/c2*16-13(17)10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10;/h2*1-7H,(H,16,17);/q;;+2/p-2 |
| InChIKey | YEJKVPDLDGAMSL-UHFFFAOYSA-L |
| XLogP | 2.29 |
| TPSA | 131.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|