C28H22CuN2O4 — CID 139081296
copper;bis(2-methylbenzoate);1,10-phenanthroline (PubChem CID 139081296) has the molecular formula C28H22CuN2O4 and a molecular weight of 514.04 g/mol. Its IUPAC name is copper;bis(2-methylbenzoate);1,10-phenanthroline.
| Compound Name | copper;bis(2-methylbenzoate);1,10-phenanthroline |
|---|---|
| PubChem CID | 139081296 |
| Molecular Formula | C28H22CuN2O4 |
| Molecular Weight | 514.04 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | copper;bis(2-methylbenzoate);1,10-phenanthroline |
| SMILES | Cc1ccccc1C(=O)[O-].Cc1ccccc1C(=O)[O-].[Cu+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2C8H8O2.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*1-6-4-2-3-5-7(6)8(9)10;/h1-8H;2*2-5H,1H3,(H,9,10);/q;;;+2/p-2 |
| InChIKey | AZFQSWOIUMZWPG-UHFFFAOYSA-L |
| XLogP | 3.50 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.04 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|