About 2-methylbenzamide;quinolin-8-amine
2-methylbenzamide;quinolin-8-amine (PubChem CID 174903342) has the molecular formula C17H17N3O
and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-methylbenzamide;quinolin-8-amine.
Molecular Properties
| Compound Name | 2-methylbenzamide;quinolin-8-amine |
| PubChem CID | 174903342 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-methylbenzamide;quinolin-8-amine |
| SMILES | Cc1ccccc1C(N)=O.Nc1cccc2cccnc12 |
| InChI | InChI=1S/C9H8N2.C8H9NO/c10-8-5-1-3-7-4-2-6-11-9(7)8;1-6-4-2-3-5-7(6)8(9)10/h1-6H,10H2;2-5H,1H3,(H2,9,10) |
| InChIKey | IFQFUXFPNVSZQQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzamide;quinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzamide;quinolin-8-amine?
The IUPAC name of 2-methylbenzamide;quinolin-8-amine (CID 174903342) is 2-methylbenzamide;quinolin-8-amine.
What is the SMILES notation for 2-methylbenzamide;quinolin-8-amine?
The canonical SMILES for 2-methylbenzamide;quinolin-8-amine is Cc1ccccc1C(N)=O.Nc1cccc2cccnc12.
What is the InChIKey of 2-methylbenzamide;quinolin-8-amine?
The InChIKey is IFQFUXFPNVSZQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C8H9NO/c10-8-5-1-3-7-4-2-6-11-9(7)8;1-6-4-2-3-5-7(6)8(9)10/h1-6H,10H2;2-5H,1H3,(H2,9,10).
What are the key properties of 2-methylbenzamide;quinolin-8-amine?
2-methylbenzamide;quinolin-8-amine has a molecular weight of 279.34 g/mol, XLogP of 2.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzamide;quinolin-8-amine is sourced from PubChem (CID 174903342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).