About carbamoperoxoic acid;quinolin-8-ol
carbamoperoxoic acid;quinolin-8-ol (PubChem CID 175492056) has the molecular formula C10H10N2O4
and a molecular weight of 222.20 g/mol. Its IUPAC name is carbamoperoxoic acid;quinolin-8-ol.
Molecular Properties
| Compound Name | carbamoperoxoic acid;quinolin-8-ol |
| PubChem CID | 175492056 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | carbamoperoxoic acid;quinolin-8-ol |
| SMILES | NC(=O)OO.Oc1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NO.CH3NO3/c11-8-5-1-3-7-4-2-6-10-9(7)8;2-1(3)5-4/h1-6,11H;4H,(H2,2,3) |
| InChIKey | UOAZZEGEBNWHLS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carbamoperoxoic acid;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoperoxoic acid;quinolin-8-ol?
The IUPAC name of carbamoperoxoic acid;quinolin-8-ol (CID 175492056) is carbamoperoxoic acid;quinolin-8-ol.
What is the SMILES notation for carbamoperoxoic acid;quinolin-8-ol?
The canonical SMILES for carbamoperoxoic acid;quinolin-8-ol is NC(=O)OO.Oc1cccc2cccnc12.
What is the InChIKey of carbamoperoxoic acid;quinolin-8-ol?
The InChIKey is UOAZZEGEBNWHLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.CH3NO3/c11-8-5-1-3-7-4-2-6-10-9(7)8;2-1(3)5-4/h1-6,11H;4H,(H2,2,3).
What are the key properties of carbamoperoxoic acid;quinolin-8-ol?
carbamoperoxoic acid;quinolin-8-ol has a molecular weight of 222.20 g/mol, XLogP of 1.50, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoperoxoic acid;quinolin-8-ol is sourced from PubChem (CID 175492056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).