About dipotassium;quinolin-8-ol;carbonate
dipotassium;quinolin-8-ol;carbonate (PubChem CID 174968438) has the molecular formula C10H7K2NO4
and a molecular weight of 283.37 g/mol. Its IUPAC name is dipotassium;quinolin-8-ol;carbonate.
Molecular Properties
| Compound Name | dipotassium;quinolin-8-ol;carbonate |
| PubChem CID | 174968438 |
| Molecular Formula | C10H7K2NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 282.96 |
| IUPAC Name | dipotassium;quinolin-8-ol;carbonate |
| SMILES | O=C([O-])[O-].Oc1cccc2cccnc12.[K+].[K+] |
| InChI | InChI=1S/C9H7NO.CH2O3.2K/c11-8-5-1-3-7-4-2-6-10-9(7)8;2-1(3)4;;/h1-6,11H;(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | DAQDTKONAFJSFA-UHFFFAOYSA-L |
| XLogP | -6.50 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dipotassium;quinolin-8-ol;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;quinolin-8-ol;carbonate?
The IUPAC name of dipotassium;quinolin-8-ol;carbonate (CID 174968438) is dipotassium;quinolin-8-ol;carbonate.
What is the SMILES notation for dipotassium;quinolin-8-ol;carbonate?
The canonical SMILES for dipotassium;quinolin-8-ol;carbonate is O=C([O-])[O-].Oc1cccc2cccnc12.[K+].[K+].
What is the InChIKey of dipotassium;quinolin-8-ol;carbonate?
The InChIKey is DAQDTKONAFJSFA-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7NO.CH2O3.2K/c11-8-5-1-3-7-4-2-6-10-9(7)8;2-1(3)4;;/h1-6,11H;(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of dipotassium;quinolin-8-ol;carbonate?
dipotassium;quinolin-8-ol;carbonate has a molecular weight of 283.37 g/mol, XLogP of -6.50, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;quinolin-8-ol;carbonate is sourced from PubChem (CID 174968438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).