About copper;quinolin-8-ol;diacetate
copper;quinolin-8-ol;diacetate (PubChem CID 161290532) has the molecular formula C13H13CuNO5
and a molecular weight of 326.80 g/mol. Its IUPAC name is copper;quinolin-8-ol;diacetate.
Molecular Properties
| Compound Name | copper;quinolin-8-ol;diacetate |
| PubChem CID | 161290532 |
| Molecular Formula | C13H13CuNO5 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | copper;quinolin-8-ol;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].Oc1cccc2cccnc12.[Cu+2] |
| InChI | InChI=1S/C9H7NO.2C2H4O2.Cu/c11-8-5-1-3-7-4-2-6-10-9(7)8;2*1-2(3)4;/h1-6,11H;2*1H3,(H,3,4);/q;;;+2/p-2 |
| InChIKey | VGHADIGRPRMCBR-UHFFFAOYSA-L |
| XLogP | -0.55 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze copper;quinolin-8-ol;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;quinolin-8-ol;diacetate?
The IUPAC name of copper;quinolin-8-ol;diacetate (CID 161290532) is copper;quinolin-8-ol;diacetate.
What is the SMILES notation for copper;quinolin-8-ol;diacetate?
The canonical SMILES for copper;quinolin-8-ol;diacetate is CC(=O)[O-].CC(=O)[O-].Oc1cccc2cccnc12.[Cu+2].
What is the InChIKey of copper;quinolin-8-ol;diacetate?
The InChIKey is VGHADIGRPRMCBR-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7NO.2C2H4O2.Cu/c11-8-5-1-3-7-4-2-6-10-9(7)8;2*1-2(3)4;/h1-6,11H;2*1H3,(H,3,4);/q;;;+2/p-2.
What are the key properties of copper;quinolin-8-ol;diacetate?
copper;quinolin-8-ol;diacetate has a molecular weight of 326.80 g/mol, XLogP of -0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;quinolin-8-ol;diacetate is sourced from PubChem (CID 161290532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).