About dipotassium;quinolin-8-ol;sulfate
dipotassium;quinolin-8-ol;sulfate (PubChem CID 24820574) has the molecular formula C9H7K2NO5S
and a molecular weight of 319.42 g/mol. Its IUPAC name is dipotassium;quinolin-8-ol;sulfate.
Molecular Properties
| Compound Name | dipotassium;quinolin-8-ol;sulfate |
| PubChem CID | 24820574 |
| Molecular Formula | C9H7K2NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | dipotassium;quinolin-8-ol;sulfate |
| SMILES | O=S(=O)([O-])[O-].Oc1cccc2cccnc12.[K+].[K+] |
| InChI | InChI=1S/C9H7NO.2K.H2O4S/c11-8-5-1-3-7-4-2-6-10-9(7)8;;;1-5(2,3)4/h1-6,11H;;;(H2,1,2,3,4)/q;2*+1;/p-2 |
| InChIKey | YNCMTKURLYZSQT-UHFFFAOYSA-L |
| XLogP | -5.39 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | -5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;quinolin-8-ol;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;quinolin-8-ol;sulfate?
The IUPAC name of dipotassium;quinolin-8-ol;sulfate (CID 24820574) is dipotassium;quinolin-8-ol;sulfate.
What is the SMILES notation for dipotassium;quinolin-8-ol;sulfate?
The canonical SMILES for dipotassium;quinolin-8-ol;sulfate is O=S(=O)([O-])[O-].Oc1cccc2cccnc12.[K+].[K+].
What is the InChIKey of dipotassium;quinolin-8-ol;sulfate?
The InChIKey is YNCMTKURLYZSQT-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7NO.2K.H2O4S/c11-8-5-1-3-7-4-2-6-10-9(7)8;;;1-5(2,3)4/h1-6,11H;;;(H2,1,2,3,4)/q;2*+1;/p-2.
What are the key properties of dipotassium;quinolin-8-ol;sulfate?
dipotassium;quinolin-8-ol;sulfate has a molecular weight of 319.42 g/mol, XLogP of -5.39, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;quinolin-8-ol;sulfate is sourced from PubChem (CID 24820574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).