About ethane;quinolin-8-amine
ethane;quinolin-8-amine (PubChem CID 91158659) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is ethane;quinolin-8-amine.
Molecular Properties
| Compound Name | ethane;quinolin-8-amine |
| PubChem CID | 91158659 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | ethane;quinolin-8-amine |
| SMILES | CC.Nc1cccc2cccnc12 |
| InChI | InChI=1S/C9H8N2.C2H6/c10-8-5-1-3-7-4-2-6-11-9(7)8;1-2/h1-6H,10H2;1-2H3 |
| InChIKey | ANSROTSOCJMERU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;quinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;quinolin-8-amine?
The IUPAC name of ethane;quinolin-8-amine (CID 91158659) is ethane;quinolin-8-amine.
What is the SMILES notation for ethane;quinolin-8-amine?
The canonical SMILES for ethane;quinolin-8-amine is CC.Nc1cccc2cccnc12.
What is the InChIKey of ethane;quinolin-8-amine?
The InChIKey is ANSROTSOCJMERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C2H6/c10-8-5-1-3-7-4-2-6-11-9(7)8;1-2/h1-6H,10H2;1-2H3.
What are the key properties of ethane;quinolin-8-amine?
ethane;quinolin-8-amine has a molecular weight of 174.25 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;quinolin-8-amine is sourced from PubChem (CID 91158659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).