C19H16N2O6S2Zn — CID 175008828
naphthalene-1,5-disulfonic acid;quinolin-8-amine;zinc (PubChem CID 175008828) has the molecular formula C19H16N2O6S2Zn and a molecular weight of 497.87 g/mol. Its IUPAC name is naphthalene-1,5-disulfonic acid;quinolin-8-amine;zinc.
| Compound Name | naphthalene-1,5-disulfonic acid;quinolin-8-amine;zinc |
|---|---|
| PubChem CID | 175008828 |
| Molecular Formula | C19H16N2O6S2Zn |
| Molecular Weight | 497.87 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | naphthalene-1,5-disulfonic acid;quinolin-8-amine;zinc |
| SMILES | Nc1cccc2cccnc12.O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12.[Zn] |
| InChI | InChI=1S/C10H8O6S2.C9H8N2.Zn/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;10-8-5-1-3-7-4-2-6-11-9(7)8;/h1-6H,(H,11,12,13)(H,14,15,16);1-6H,10H2; |
| InChIKey | UCAIPGZAZOWTIR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.87 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|