About 2-chloroaniline;quinolin-8-ol
2-chloroaniline;quinolin-8-ol (PubChem CID 70504979) has the molecular formula C15H13ClN2O
and a molecular weight of 272.74 g/mol. Its IUPAC name is 2-chloroaniline;quinolin-8-ol.
Molecular Properties
| Compound Name | 2-chloroaniline;quinolin-8-ol |
| PubChem CID | 70504979 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-chloroaniline;quinolin-8-ol |
| SMILES | Nc1ccccc1Cl.Oc1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NO.C6H6ClN/c11-8-5-1-3-7-4-2-6-10-9(7)8;7-5-3-1-2-4-6(5)8/h1-6,11H;1-4H,8H2 |
| InChIKey | PMHYJRIRRJDSRT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroaniline;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroaniline;quinolin-8-ol?
The IUPAC name of 2-chloroaniline;quinolin-8-ol (CID 70504979) is 2-chloroaniline;quinolin-8-ol.
What is the SMILES notation for 2-chloroaniline;quinolin-8-ol?
The canonical SMILES for 2-chloroaniline;quinolin-8-ol is Nc1ccccc1Cl.Oc1cccc2cccnc12.
What is the InChIKey of 2-chloroaniline;quinolin-8-ol?
The InChIKey is PMHYJRIRRJDSRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C6H6ClN/c11-8-5-1-3-7-4-2-6-10-9(7)8;7-5-3-1-2-4-6(5)8/h1-6,11H;1-4H,8H2.
What are the key properties of 2-chloroaniline;quinolin-8-ol?
2-chloroaniline;quinolin-8-ol has a molecular weight of 272.74 g/mol, XLogP of 3.86, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroaniline;quinolin-8-ol is sourced from PubChem (CID 70504979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).