About 4-aminophenol;quinolin-8-ol
4-aminophenol;quinolin-8-ol (PubChem CID 175315469) has the molecular formula C15H14N2O2
and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-aminophenol;quinolin-8-ol.
Molecular Properties
| Compound Name | 4-aminophenol;quinolin-8-ol |
| PubChem CID | 175315469 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 4-aminophenol;quinolin-8-ol |
| SMILES | Nc1ccc(O)cc1.Oc1cccc2cccnc12 |
| InChI | InChI=1S/C9H7NO.C6H7NO/c11-8-5-1-3-7-4-2-6-10-9(7)8;7-5-1-3-6(8)4-2-5/h1-6,11H;1-4,8H,7H2 |
| InChIKey | UDXFXMVDAQXPTM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-aminophenol;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminophenol;quinolin-8-ol?
The IUPAC name of 4-aminophenol;quinolin-8-ol (CID 175315469) is 4-aminophenol;quinolin-8-ol.
What is the SMILES notation for 4-aminophenol;quinolin-8-ol?
The canonical SMILES for 4-aminophenol;quinolin-8-ol is Nc1ccc(O)cc1.Oc1cccc2cccnc12.
What is the InChIKey of 4-aminophenol;quinolin-8-ol?
The InChIKey is UDXFXMVDAQXPTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C6H7NO/c11-8-5-1-3-7-4-2-6-10-9(7)8;7-5-1-3-6(8)4-2-5/h1-6,11H;1-4,8H,7H2.
What are the key properties of 4-aminophenol;quinolin-8-ol?
4-aminophenol;quinolin-8-ol has a molecular weight of 254.29 g/mol, XLogP of 2.91, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminophenol;quinolin-8-ol is sourced from PubChem (CID 175315469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).