About benzo[h]quinoline-5,10-diamine
benzo[h]quinoline-5,10-diamine (PubChem CID 121329472) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is benzo[h]quinoline-5,10-diamine.
Molecular Properties
| Compound Name | benzo[h]quinoline-5,10-diamine |
| PubChem CID | 121329472 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | benzo[h]quinoline-5,10-diamine |
| SMILES | Nc1cc2cccc(N)c2c2ncccc12 |
| InChI | InChI=1S/C13H11N3/c14-10-5-1-3-8-7-11(15)9-4-2-6-16-13(9)12(8)10/h1-7H,14-15H2 |
| InChIKey | RDLZVZQPCKKUEE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[h]quinoline-5,10-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[h]quinoline-5,10-diamine?
The IUPAC name of benzo[h]quinoline-5,10-diamine (CID 121329472) is benzo[h]quinoline-5,10-diamine.
What is the SMILES notation for benzo[h]quinoline-5,10-diamine?
The canonical SMILES for benzo[h]quinoline-5,10-diamine is Nc1cc2cccc(N)c2c2ncccc12.
What is the InChIKey of benzo[h]quinoline-5,10-diamine?
The InChIKey is RDLZVZQPCKKUEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c14-10-5-1-3-8-7-11(15)9-4-2-6-16-13(9)12(8)10/h1-7H,14-15H2.
What are the key properties of benzo[h]quinoline-5,10-diamine?
benzo[h]quinoline-5,10-diamine has a molecular weight of 209.25 g/mol, XLogP of 2.55, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[h]quinoline-5,10-diamine is sourced from PubChem (CID 121329472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).