C13H11N3 — CID 121329472
benzo[h]quinoline-5,10-diamine (PubChem CID 121329472) has the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. Its IUPAC name is benzo[h]quinoline-5,10-diamine.
| Compound Name | benzo[h]quinoline-5,10-diamine |
|---|---|
| PubChem CID | 121329472 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | benzo[h]quinoline-5,10-diamine |
| SMILES | Nc1cc2cccc(N)c2c2ncccc12 |
| InChI | InChI=1S/C13H11N3/c14-10-5-1-3-8-7-11(15)9-4-2-6-16-13(9)12(8)10/h1-7H,14-15H2 |
| InChIKey | RDLZVZQPCKKUEE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|