About di(quinolin-8-yl)azanide;titanium
di(quinolin-8-yl)azanide;titanium (PubChem CID 20827876) has the molecular formula C18H12N3Ti-
and a molecular weight of 318.18 g/mol. Its IUPAC name is di(quinolin-8-yl)azanide;titanium.
Molecular Properties
| Compound Name | di(quinolin-8-yl)azanide;titanium |
| PubChem CID | 20827876 |
| Molecular Formula | C18H12N3Ti- |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | di(quinolin-8-yl)azanide;titanium |
| SMILES | [Ti].c1cnc2c([N-]c3cccc4cccnc34)cccc2c1 |
| InChI | InChI=1S/C18H12N3.Ti/c1-5-13-7-3-11-19-17(13)15(9-1)21-16-10-2-6-14-8-4-12-20-18(14)16;/h1-12H;/q-1; |
| InChIKey | VISNAOPVELMKEE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze di(quinolin-8-yl)azanide;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(quinolin-8-yl)azanide;titanium?
The IUPAC name of di(quinolin-8-yl)azanide;titanium (CID 20827876) is di(quinolin-8-yl)azanide;titanium.
What is the SMILES notation for di(quinolin-8-yl)azanide;titanium?
The canonical SMILES for di(quinolin-8-yl)azanide;titanium is [Ti].c1cnc2c([N-]c3cccc4cccnc34)cccc2c1.
What is the InChIKey of di(quinolin-8-yl)azanide;titanium?
The InChIKey is VISNAOPVELMKEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N3.Ti/c1-5-13-7-3-11-19-17(13)15(9-1)21-16-10-2-6-14-8-4-12-20-18(14)16;/h1-12H;/q-1;.
What are the key properties of di(quinolin-8-yl)azanide;titanium?
di(quinolin-8-yl)azanide;titanium has a molecular weight of 318.18 g/mol, XLogP of 5.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for di(quinolin-8-yl)azanide;titanium is sourced from PubChem (CID 20827876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).